C31H27ClN2O7 — CID 125428035
(2S,4'S,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-[3-(pyridin-3-ylmethoxy)phenyl]spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione (PubChem CID 125428035) has the molecular formula C31H27ClN2O7 and a molecular weight of 575.02 g/mol. Its IUPAC name is (2S,4'S,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-[3-(pyridin-3-ylmethoxy)phenyl]spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione.
| Compound Name | (2S,4'S,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-[3-(pyridin-3-ylmethoxy)phenyl]spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 125428035 |
| Molecular Formula | C31H27ClN2O7 |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | (2S,4'S,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-[3-(pyridin-3-ylmethoxy)phenyl]spiro[1-benzofuran-2,6'-3,4,7,8-tetrahydro-1H-quinoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)NC(=O)C[C@H]3c1cccc(OCc3cccnc3)c1)C2=O |
| InChI | InChI=1S/C31H27ClN2O7/c1-16-10-21-25(29(36)31(16)30(37)26-22(38-2)13-23(39-3)27(32)28(26)41-31)20(12-24(35)34-21)18-7-4-8-19(11-18)40-15-17-6-5-9-33-14-17/h4-9,11,13-14,16,20H,10,12,15H2,1-3H3,(H,34,35)/t16-,20+,31+/m1/s1 |
| InChIKey | SURKYUKYXUPNET-SDFBSAGKSA-N |
| XLogP | 4.81 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|