C29H26ClN4O9- — CID 163171843
(2S,8'R)-7-chloro-5'-[4-[hydroxy(oxido)amino]phenyl]-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone (PubChem CID 163171843) has the molecular formula C29H26ClN4O9- and a molecular weight of 610.00 g/mol. Its IUPAC name is (2S,8'R)-7-chloro-5'-[4-[hydroxy(oxido)amino]phenyl]-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone.
| Compound Name | (2S,8'R)-7-chloro-5'-[4-[hydroxy(oxido)amino]phenyl]-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
|---|---|
| PubChem CID | 163171843 |
| Molecular Formula | C29H26ClN4O9- |
| Molecular Weight | 610.00 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | (2S,8'R)-7-chloro-5'-[4-[hydroxy(oxido)amino]phenyl]-4,6-dimethoxy-1',3',8'-trimethylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)Nc1c(c(=O)n(C)c(=O)n1C)C3c1ccc(N([O-])O)cc1)C2=O |
| InChI | InChI=1S/C29H26ClN4O9/c1-12-10-15-19(24(35)29(12)25(36)20-16(41-4)11-17(42-5)22(30)23(20)43-29)18(13-6-8-14(9-7-13)34(39)40)21-26(31-15)32(2)28(38)33(3)27(21)37/h6-9,11-12,18,31,39H,10H2,1-5H3/q-1/t12-,18?,29+/m1/s1 |
| InChIKey | DCMKXRURRRCIIU-MMLLSBTESA-N |
| XLogP | 2.88 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.00 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|