C27H22ClN3O7 — CID 163053781
7-chloro-4,6-dimethoxy-8'-methyl-5'-phenylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone (PubChem CID 163053781) has the molecular formula C27H22ClN3O7 and a molecular weight of 535.94 g/mol. Its IUPAC name is 7-chloro-4,6-dimethoxy-8'-methyl-5'-phenylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone.
| Compound Name | 7-chloro-4,6-dimethoxy-8'-methyl-5'-phenylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
|---|---|
| PubChem CID | 163053781 |
| Molecular Formula | C27H22ClN3O7 |
| Molecular Weight | 535.94 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 7-chloro-4,6-dimethoxy-8'-methyl-5'-phenylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)C3=C(CC1C)Nc1[nH]c(=O)[nH]c(=O)c1C3c1ccccc1)C2=O |
| InChI | InChI=1S/C27H22ClN3O7/c1-11-9-13-17(16(12-7-5-4-6-8-12)19-24(29-13)30-26(35)31-25(19)34)22(32)27(11)23(33)18-14(36-2)10-15(37-3)20(28)21(18)38-27/h4-8,10-11,16H,9H2,1-3H3,(H3,29,30,31,34,35) |
| InChIKey | NAFOWZXTXVFKNW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.94 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|