C24H21ClO6 — CID 118254103
(2S,3'R,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-3'-phenylspiro[1-benzofuran-2,5'-2,3,6,7-tetrahydro-1-benzofuran]-3,4'-dione (PubChem CID 118254103) has the molecular formula C24H21ClO6 and a molecular weight of 440.88 g/mol. Its IUPAC name is (2S,3'R,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-3'-phenylspiro[1-benzofuran-2,5'-2,3,6,7-tetrahydro-1-benzofuran]-3,4'-dione.
| Compound Name | (2S,3'R,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-3'-phenylspiro[1-benzofuran-2,5'-2,3,6,7-tetrahydro-1-benzofuran]-3,4'-dione |
|---|---|
| PubChem CID | 118254103 |
| Molecular Formula | C24H21ClO6 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (2S,3'R,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-3'-phenylspiro[1-benzofuran-2,5'-2,3,6,7-tetrahydro-1-benzofuran]-3,4'-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)OC[C@@H]3c1ccccc1)C2=O |
| InChI | InChI=1S/C24H21ClO6/c1-12-9-16-18(14(11-30-16)13-7-5-4-6-8-13)22(26)24(12)23(27)19-15(28-2)10-17(29-3)20(25)21(19)31-24/h4-8,10,12,14H,9,11H2,1-3H3/t12-,14-,24+/m1/s1 |
| InChIKey | AZQIJNBWYDEOCT-XYWAVCLCSA-N |
| XLogP | 4.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|