C26H26ClNO6 — CID 73330767
(6S,7S)-7'-chloro-2-(hydroxymethyl)-4',6'-dimethoxy-7-methyl-4-phenylspiro[1,2,3,4,7,8-hexahydroquinoline-6,2'-1-benzofuran]-3',5-dione (PubChem CID 73330767) has the molecular formula C26H26ClNO6 and a molecular weight of 483.95 g/mol. Its IUPAC name is (6S,7S)-7'-chloro-2-(hydroxymethyl)-4',6'-dimethoxy-7-methyl-4-phenylspiro[1,2,3,4,7,8-hexahydroquinoline-6,2'-1-benzofuran]-3',5-dione.
| Compound Name | (6S,7S)-7'-chloro-2-(hydroxymethyl)-4',6'-dimethoxy-7-methyl-4-phenylspiro[1,2,3,4,7,8-hexahydroquinoline-6,2'-1-benzofuran]-3',5-dione |
|---|---|
| PubChem CID | 73330767 |
| Molecular Formula | C26H26ClNO6 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (6S,7S)-7'-chloro-2-(hydroxymethyl)-4',6'-dimethoxy-7-methyl-4-phenylspiro[1,2,3,4,7,8-hexahydroquinoline-6,2'-1-benzofuran]-3',5-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@@H]1C)NC(CO)CC3c1ccccc1)C2=O |
| InChI | InChI=1S/C26H26ClNO6/c1-13-9-17-20(16(10-15(12-29)28-17)14-7-5-4-6-8-14)24(30)26(13)25(31)21-18(32-2)11-19(33-3)22(27)23(21)34-26/h4-8,11,13,15-16,28-29H,9-10,12H2,1-3H3/t13-,15?,16?,26-/m0/s1 |
| InChIKey | LLQGWRSXWCEDQT-AKLOFOOHSA-N |
| XLogP | 3.67 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|