C31H26ClNO7 — CID 118254160
methyl (4R,6S,7R)-7'-chloro-4',6'-dimethoxy-7-methyl-4-naphthalen-2-yl-3',5-dioxospiro[1,4,7,8-tetrahydroquinoline-6,2'-1-benzofuran]-2-carboxylate (PubChem CID 118254160) has the molecular formula C31H26ClNO7 and a molecular weight of 560.00 g/mol. Its IUPAC name is methyl (4R,6S,7R)-7'-chloro-4',6'-dimethoxy-7-methyl-4-naphthalen-2-yl-3',5-dioxospiro[1,4,7,8-tetrahydroquinoline-6,2'-1-benzofuran]-2-carboxylate.
| Compound Name | methyl (4R,6S,7R)-7'-chloro-4',6'-dimethoxy-7-methyl-4-naphthalen-2-yl-3',5-dioxospiro[1,4,7,8-tetrahydroquinoline-6,2'-1-benzofuran]-2-carboxylate |
|---|---|
| PubChem CID | 118254160 |
| Molecular Formula | C31H26ClNO7 |
| Molecular Weight | 560.00 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | methyl (4R,6S,7R)-7'-chloro-4',6'-dimethoxy-7-methyl-4-naphthalen-2-yl-3',5-dioxospiro[1,4,7,8-tetrahydroquinoline-6,2'-1-benzofuran]-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H](c2ccc3ccccc3c2)C2=C(C[C@@H](C)[C@]3(Oc4c(Cl)c(OC)cc(OC)c4C3=O)C2=O)N1 |
| InChI | InChI=1S/C31H26ClNO7/c1-15-11-20-24(28(34)31(15)29(35)25-22(37-2)14-23(38-3)26(32)27(25)40-31)19(13-21(33-20)30(36)39-4)18-10-9-16-7-5-6-8-17(16)12-18/h5-10,12-15,19,33H,11H2,1-4H3/t15-,19-,31+/m1/s1 |
| InChIKey | YXXQXRLPQMVGNH-GDGOIWHQSA-N |
| XLogP | 5.13 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|