C26H23ClN4O6 — CID 137243631
(2S,6'R)-7-chloro-4,6-dimethoxy-9'-(4-methoxyphenyl)-6'-methylspiro[1-benzofuran-2,7'-4,5,6,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazoline]-3,8'-dione (PubChem CID 137243631) has the molecular formula C26H23ClN4O6 and a molecular weight of 522.95 g/mol. Its IUPAC name is (2S,6'R)-7-chloro-4,6-dimethoxy-9'-(4-methoxyphenyl)-6'-methylspiro[1-benzofuran-2,7'-4,5,6,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazoline]-3,8'-dione.
| Compound Name | (2S,6'R)-7-chloro-4,6-dimethoxy-9'-(4-methoxyphenyl)-6'-methylspiro[1-benzofuran-2,7'-4,5,6,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazoline]-3,8'-dione |
|---|---|
| PubChem CID | 137243631 |
| Molecular Formula | C26H23ClN4O6 |
| Molecular Weight | 522.95 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | (2S,6'R)-7-chloro-4,6-dimethoxy-9'-(4-methoxyphenyl)-6'-methylspiro[1-benzofuran-2,7'-4,5,6,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazoline]-3,8'-dione |
| SMILES | COc1ccc(C2C3=C(C[C@@H](C)[C@]4(Oc5c(Cl)c(OC)cc(OC)c5C4=O)C3=O)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C26H23ClN4O6/c1-12-9-15-18(21(31-25(30-15)28-11-29-31)13-5-7-14(34-2)8-6-13)23(32)26(12)24(33)19-16(35-3)10-17(36-4)20(27)22(19)37-26/h5-8,10-12,21H,9H2,1-4H3,(H,28,29,30)/t12-,21?,26+/m1/s1 |
| InChIKey | OVWHASSEUIBLKN-ARWCLHOTSA-N |
| XLogP | 3.85 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|