C26H23ClN4O7 — CID 135639913
7-chloro-9'-(3-hydroxy-4-methoxyphenyl)-4,6-dimethoxy-6'-methylspiro[1-benzofuran-2,7'-4,5,6,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazoline]-3,8'-dione (PubChem CID 135639913) has the molecular formula C26H23ClN4O7 and a molecular weight of 538.94 g/mol. Its IUPAC name is 7-chloro-9'-(3-hydroxy-4-methoxyphenyl)-4,6-dimethoxy-6'-methylspiro[1-benzofuran-2,7'-4,5,6,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazoline]-3,8'-dione.
| Compound Name | 7-chloro-9'-(3-hydroxy-4-methoxyphenyl)-4,6-dimethoxy-6'-methylspiro[1-benzofuran-2,7'-4,5,6,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazoline]-3,8'-dione |
|---|---|
| PubChem CID | 135639913 |
| Molecular Formula | C26H23ClN4O7 |
| Molecular Weight | 538.94 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 7-chloro-9'-(3-hydroxy-4-methoxyphenyl)-4,6-dimethoxy-6'-methylspiro[1-benzofuran-2,7'-4,5,6,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazoline]-3,8'-dione |
| SMILES | COc1ccc(C2C3=C(CC(C)C4(Oc5c(Cl)c(OC)cc(OC)c5C4=O)C3=O)Nc3ncnn32)cc1O |
| InChI | InChI=1S/C26H23ClN4O7/c1-11-7-13-18(21(31-25(30-13)28-10-29-31)12-5-6-15(35-2)14(32)8-12)23(33)26(11)24(34)19-16(36-3)9-17(37-4)20(27)22(19)38-26/h5-6,8-11,21,32H,7H2,1-4H3,(H,28,29,30) |
| InChIKey | NZUYYKABWAYVTD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.94 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|