C27H23ClN4O6 — CID 135640805
(2S,8'R)-2'-amino-7-chloro-4,6-dimethoxy-8'-methyl-5'-phenylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline]-3,4',6'-trione (PubChem CID 135640805) has the molecular formula C27H23ClN4O6 and a molecular weight of 534.96 g/mol. Its IUPAC name is (2S,8'R)-2'-amino-7-chloro-4,6-dimethoxy-8'-methyl-5'-phenylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline]-3,4',6'-trione.
| Compound Name | (2S,8'R)-2'-amino-7-chloro-4,6-dimethoxy-8'-methyl-5'-phenylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline]-3,4',6'-trione |
|---|---|
| PubChem CID | 135640805 |
| Molecular Formula | C27H23ClN4O6 |
| Molecular Weight | 534.96 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | (2S,8'R)-2'-amino-7-chloro-4,6-dimethoxy-8'-methyl-5'-phenylspiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline]-3,4',6'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C3=C(C[C@H]1C)Nc1nc(N)[nH]c(=O)c1C3c1ccccc1)C2=O |
| InChI | InChI=1S/C27H23ClN4O6/c1-11-9-13-17(16(12-7-5-4-6-8-12)19-24(30-13)31-26(29)32-25(19)35)22(33)27(11)23(34)18-14(36-2)10-15(37-3)20(28)21(18)38-27/h4-8,10-11,16H,9H2,1-3H3,(H4,29,30,31,32,35)/t11-,16?,27+/m1/s1 |
| InChIKey | JUPJGAYFTCPYGN-ATIPVWRBSA-N |
| XLogP | 3.46 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.96 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|