C32H24Cl2N4O9 — CID 162952924
3-[5-(2'-amino-7-chloro-4,6-dimethoxy-8'-methyl-3,4',6'-trioxospiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline]-5'-yl)furan-2-yl]-4-chlorobenzoic acid (PubChem CID 162952924) has the molecular formula C32H24Cl2N4O9 and a molecular weight of 679.47 g/mol. Its IUPAC name is 3-[5-(2'-amino-7-chloro-4,6-dimethoxy-8'-methyl-3,4',6'-trioxospiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline]-5'-yl)furan-2-yl]-4-chlorobenzoic acid.
| Compound Name | 3-[5-(2'-amino-7-chloro-4,6-dimethoxy-8'-methyl-3,4',6'-trioxospiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline]-5'-yl)furan-2-yl]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 162952924 |
| Molecular Formula | C32H24Cl2N4O9 |
| Molecular Weight | 679.47 g/mol |
| Exact Mass | 678.09 |
| IUPAC Name | 3-[5-(2'-amino-7-chloro-4,6-dimethoxy-8'-methyl-3,4',6'-trioxospiro[1-benzofuran-2,7'-5,8,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline]-5'-yl)furan-2-yl]-4-chlorobenzoic acid |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)C3=C(CC1C)Nc1nc(N)[nH]c(=O)c1C3c1ccc(-c3cc(C(=O)O)ccc3Cl)o1)C2=O |
| InChI | InChI=1S/C32H24Cl2N4O9/c1-11-8-15-20(26(39)32(11)27(40)22-18(44-2)10-19(45-3)24(34)25(22)47-32)21(23-28(36-15)37-31(35)38-29(23)41)17-7-6-16(46-17)13-9-12(30(42)43)4-5-14(13)33/h4-7,9-11,21H,8H2,1-3H3,(H,42,43)(H4,35,36,37,38,41) |
| InChIKey | ZBULTJKDIADVLV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 196.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|