C23H21ClO6 — CID 56950846
(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-phenylmethoxyspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 56950846) has the molecular formula C23H21ClO6 and a molecular weight of 428.87 g/mol. Its IUPAC name is (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-phenylmethoxyspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-phenylmethoxyspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 56950846 |
| Molecular Formula | C23H21ClO6 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-phenylmethoxyspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C=C(OCc3ccccc3)C[C@H]1C)C2=O |
| InChI | InChI=1S/C23H21ClO6/c1-13-9-15(29-12-14-7-5-4-6-8-14)10-18(25)23(13)22(26)19-16(27-2)11-17(28-3)20(24)21(19)30-23/h4-8,10-11,13H,9,12H2,1-3H3/t13-,23+/m1/s1 |
| InChIKey | SPYONLUZMGZZAO-ZLOXQWCVSA-N |
| XLogP | 4.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|