C25H22ClN3O8 — CID 163094021
7-chloro-4,6-dimethoxy-1',8'-dimethyl-3'-(2-oxopropyl)spiro[1-benzofuran-2,7'-8,9-dihydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone (PubChem CID 163094021) has the molecular formula C25H22ClN3O8 and a molecular weight of 527.92 g/mol. Its IUPAC name is 7-chloro-4,6-dimethoxy-1',8'-dimethyl-3'-(2-oxopropyl)spiro[1-benzofuran-2,7'-8,9-dihydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone.
| Compound Name | 7-chloro-4,6-dimethoxy-1',8'-dimethyl-3'-(2-oxopropyl)spiro[1-benzofuran-2,7'-8,9-dihydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
|---|---|
| PubChem CID | 163094021 |
| Molecular Formula | C25H22ClN3O8 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 7-chloro-4,6-dimethoxy-1',8'-dimethyl-3'-(2-oxopropyl)spiro[1-benzofuran-2,7'-8,9-dihydropyrimido[4,5-b]quinoline]-2',3,4',6'-tetrone |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)c3cc4c(=O)n(CC(C)=O)c(=O)n(C)c4nc3CC1C)C2=O |
| InChI | InChI=1S/C25H22ClN3O8/c1-10-6-14-12(7-13-22(27-14)28(3)24(34)29(23(13)33)9-11(2)30)20(31)25(10)21(32)17-15(35-4)8-16(36-5)18(26)19(17)37-25/h7-8,10H,6,9H2,1-5H3 |
| InChIKey | SZZGFMSMCHERJR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 135.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|