C30H30ClN3O9 — CID 135640623
(2S,5'R)-7-chloro-2'-[2-(6,7-dimethoxy-2-methyl-4-oxoquinazolin-3-yl)ethyliminomethyl]-3'-hydroxy-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione (PubChem CID 135640623) has the molecular formula C30H30ClN3O9 and a molecular weight of 612.04 g/mol. Its IUPAC name is (2S,5'R)-7-chloro-2'-[2-(6,7-dimethoxy-2-methyl-4-oxoquinazolin-3-yl)ethyliminomethyl]-3'-hydroxy-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (2S,5'R)-7-chloro-2'-[2-(6,7-dimethoxy-2-methyl-4-oxoquinazolin-3-yl)ethyliminomethyl]-3'-hydroxy-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 135640623 |
| Molecular Formula | C30H30ClN3O9 |
| Molecular Weight | 612.04 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | (2S,5'R)-7-chloro-2'-[2-(6,7-dimethoxy-2-methyl-4-oxoquinazolin-3-yl)ethyliminomethyl]-3'-hydroxy-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc2nc(C)n(CC/N=C/C3=C(O)[C@@]4(Oc5c(Cl)c(OC)cc(OC)c5C4=O)[C@H](C)CC3=O)c(=O)c2cc1OC |
| InChI | InChI=1S/C30H30ClN3O9/c1-14-9-19(35)17(27(36)30(14)28(37)24-22(41-5)12-23(42-6)25(31)26(24)43-30)13-32-7-8-34-15(2)33-18-11-21(40-4)20(39-3)10-16(18)29(34)38/h10-14,36H,7-9H2,1-6H3/b32-13+/t14-,30+/m1/s1 |
| InChIKey | GDWITWAMNNEPIF-QKBJGBDXSA-N |
| XLogP | 3.90 |
| TPSA | 147.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.04 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|