C28H27ClN4O7 — CID 163093878
7-chloro-2'-[[3-[4-(dimethylamino)phenyl]-1,2,4-oxadiazol-5-yl]methyliminomethyl]-3'-hydroxy-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione (PubChem CID 163093878) has the molecular formula C28H27ClN4O7 and a molecular weight of 567.00 g/mol. Its IUPAC name is 7-chloro-2'-[[3-[4-(dimethylamino)phenyl]-1,2,4-oxadiazol-5-yl]methyliminomethyl]-3'-hydroxy-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione.
| Compound Name | 7-chloro-2'-[[3-[4-(dimethylamino)phenyl]-1,2,4-oxadiazol-5-yl]methyliminomethyl]-3'-hydroxy-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 163093878 |
| Molecular Formula | C28H27ClN4O7 |
| Molecular Weight | 567.00 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 7-chloro-2'-[[3-[4-(dimethylamino)phenyl]-1,2,4-oxadiazol-5-yl]methyliminomethyl]-3'-hydroxy-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C2=O)C(O)=C(/C=N/Cc2nc(-c3ccc(N(C)C)cc3)no2)C(=O)CC1C |
| InChI | InChI=1S/C28H27ClN4O7/c1-14-10-18(34)17(12-30-13-21-31-27(32-40-21)15-6-8-16(9-7-15)33(2)3)25(35)28(14)26(36)22-19(37-4)11-20(38-5)23(29)24(22)39-28/h6-9,11-12,14,35H,10,13H2,1-5H3/b30-12+ |
| InChIKey | CTZBNIXTYSWDTG-PNQUVVCRSA-N |
| XLogP | 4.48 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.00 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|