C24H26ClN3O8 — CID 135640228
(2S,5'R)-7-chloro-3'-hydroxy-4,6-dimethoxy-2'-[2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethyliminomethyl]-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione (PubChem CID 135640228) has the molecular formula C24H26ClN3O8 and a molecular weight of 519.94 g/mol. Its IUPAC name is (2S,5'R)-7-chloro-3'-hydroxy-4,6-dimethoxy-2'-[2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethyliminomethyl]-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (2S,5'R)-7-chloro-3'-hydroxy-4,6-dimethoxy-2'-[2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethyliminomethyl]-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 135640228 |
| Molecular Formula | C24H26ClN3O8 |
| Molecular Weight | 519.94 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | (2S,5'R)-7-chloro-3'-hydroxy-4,6-dimethoxy-2'-[2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]ethyliminomethyl]-5'-methylspiro[1-benzofuran-2,4'-cyclohex-2-ene]-1',3-dione |
| SMILES | COCCc1noc(CC/N=C/C2=C(O)[C@@]3(Oc4c(Cl)c(OC)cc(OC)c4C3=O)[C@H](C)CC2=O)n1 |
| InChI | InChI=1S/C24H26ClN3O8/c1-12-9-14(29)13(11-26-7-5-18-27-17(28-36-18)6-8-32-2)22(30)24(12)23(31)19-15(33-3)10-16(34-4)20(25)21(19)35-24/h10-12,30H,5-9H2,1-4H3/b26-11+/t12-,24+/m1/s1 |
| InChIKey | SKIZPYXNBFOZEB-GZZFKETDSA-N |
| XLogP | 2.98 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.94 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|