C21H23ClO7 — CID 144564119
(2S)-7-chloro-2'-ethoxy-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,8'-3,4,6,7-tetrahydro-2H-chromene]-3,5'-dione (PubChem CID 144564119) has the molecular formula C21H23ClO7 and a molecular weight of 422.86 g/mol. Its IUPAC name is (2S)-7-chloro-2'-ethoxy-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,8'-3,4,6,7-tetrahydro-2H-chromene]-3,5'-dione.
| Compound Name | (2S)-7-chloro-2'-ethoxy-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,8'-3,4,6,7-tetrahydro-2H-chromene]-3,5'-dione |
|---|---|
| PubChem CID | 144564119 |
| Molecular Formula | C21H23ClO7 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (2S)-7-chloro-2'-ethoxy-4,6-dimethoxy-7'-methylspiro[1-benzofuran-2,8'-3,4,6,7-tetrahydro-2H-chromene]-3,5'-dione |
| SMILES | CCOC1CCC2=C(O1)[C@@]1(Oc3c(Cl)c(OC)cc(OC)c3C1=O)C(C)CC2=O |
| InChI | InChI=1S/C21H23ClO7/c1-5-27-15-7-6-11-12(23)8-10(2)21(20(11)28-15)19(24)16-13(25-3)9-14(26-4)17(22)18(16)29-21/h9-10,15H,5-8H2,1-4H3/t10?,15?,21-/m1/s1 |
| InChIKey | YJCHRBGEDNSUQQ-HPPBBHNFSA-N |
| XLogP | 3.71 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |