C26H25ClO7 — CID 118263244
(2S,6'R)-7-chloro-2'-(2-hydroxyethyl)-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione (PubChem CID 118263244) has the molecular formula C26H25ClO7 and a molecular weight of 484.93 g/mol. Its IUPAC name is (2S,6'R)-7-chloro-2'-(2-hydroxyethyl)-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione.
| Compound Name | (2S,6'R)-7-chloro-2'-(2-hydroxyethyl)-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione |
|---|---|
| PubChem CID | 118263244 |
| Molecular Formula | C26H25ClO7 |
| Molecular Weight | 484.93 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (2S,6'R)-7-chloro-2'-(2-hydroxyethyl)-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C2=C(CC(CCO)(c3ccccc3)O2)C(=O)C[C@H]1C |
| InChI | InChI=1S/C26H25ClO7/c1-14-11-17(29)16-13-25(9-10-28,15-7-5-4-6-8-15)34-24(16)26(14)23(30)20-18(31-2)12-19(32-3)21(27)22(20)33-26/h4-8,12,14,28H,9-11,13H2,1-3H3/t14-,25?,26-/m1/s1 |
| InChIKey | NWIRMVAINQIMGM-GBJQPFTRSA-N |
| XLogP | 4.23 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |