C31H35ClN2O6 — CID 73331631
(2S,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-2'-[2-(4-methylpiperazin-1-yl)ethyl]-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione (PubChem CID 73331631) has the molecular formula C31H35ClN2O6 and a molecular weight of 567.08 g/mol. Its IUPAC name is (2S,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-2'-[2-(4-methylpiperazin-1-yl)ethyl]-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione.
| Compound Name | (2S,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-2'-[2-(4-methylpiperazin-1-yl)ethyl]-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione |
|---|---|
| PubChem CID | 73331631 |
| Molecular Formula | C31H35ClN2O6 |
| Molecular Weight | 567.08 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | (2S,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-2'-[2-(4-methylpiperazin-1-yl)ethyl]-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C2=C(CC(CCN3CCN(C)CC3)(c3ccccc3)O2)C(=O)C[C@H]1C |
| InChI | InChI=1S/C31H35ClN2O6/c1-19-16-22(35)21-18-30(20-8-6-5-7-9-20,10-11-34-14-12-33(2)13-15-34)40-29(21)31(19)28(36)25-23(37-3)17-24(38-4)26(32)27(25)39-31/h5-9,17,19H,10-16,18H2,1-4H3/t19-,30?,31-/m1/s1 |
| InChIKey | YBPIJGHWNNRLMY-VSVGVIERSA-N |
| XLogP | 4.49 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.08 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |