C28H27ClO8 — CID 118263246
2-[(2S,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-3,4'-dioxo-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-2'-yl]ethyl acetate (PubChem CID 118263246) has the molecular formula C28H27ClO8 and a molecular weight of 526.97 g/mol. Its IUPAC name is 2-[(2S,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-3,4'-dioxo-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-2'-yl]ethyl acetate.
| Compound Name | 2-[(2S,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-3,4'-dioxo-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-2'-yl]ethyl acetate |
|---|---|
| PubChem CID | 118263246 |
| Molecular Formula | C28H27ClO8 |
| Molecular Weight | 526.97 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 2-[(2S,6'R)-7-chloro-4,6-dimethoxy-6'-methyl-3,4'-dioxo-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-2'-yl]ethyl acetate |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C2=C(CC(CCOC(C)=O)(c3ccccc3)O2)C(=O)C[C@H]1C |
| InChI | InChI=1S/C28H27ClO8/c1-15-12-19(31)18-14-27(10-11-35-16(2)30,17-8-6-5-7-9-17)37-26(18)28(15)25(32)22-20(33-3)13-21(34-4)23(29)24(22)36-28/h5-9,13,15H,10-12,14H2,1-4H3/t15-,27?,28-/m1/s1 |
| InChIKey | ANCNSUXIBIXEJP-CQYIRWNQSA-N |
| XLogP | 4.80 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.97 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |