C28H29ClO7 — CID 73330912
(2S,2'R,6'R)-7-chloro-2'-(4-hydroxybutyl)-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione (PubChem CID 73330912) has the molecular formula C28H29ClO7 and a molecular weight of 512.99 g/mol. Its IUPAC name is (2S,2'R,6'R)-7-chloro-2'-(4-hydroxybutyl)-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione.
| Compound Name | (2S,2'R,6'R)-7-chloro-2'-(4-hydroxybutyl)-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione |
|---|---|
| PubChem CID | 73330912 |
| Molecular Formula | C28H29ClO7 |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (2S,2'R,6'R)-7-chloro-2'-(4-hydroxybutyl)-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C2=C(C[C@](CCCCO)(c3ccccc3)O2)C(=O)C[C@H]1C |
| InChI | InChI=1S/C28H29ClO7/c1-16-13-19(31)18-15-27(11-7-8-12-30,17-9-5-4-6-10-17)36-26(18)28(16)25(32)22-20(33-2)14-21(34-3)23(29)24(22)35-28/h4-6,9-10,14,16,30H,7-8,11-13,15H2,1-3H3/t16-,27-,28-/m1/s1 |
| InChIKey | LSVDGMZEAWHEEV-XBJZADGRSA-N |
| XLogP | 5.01 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|