C26H24BrClO6 — CID 73331628
(2S,2'R,6'R)-2'-(2-bromoethyl)-7-chloro-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione (PubChem CID 73331628) has the molecular formula C26H24BrClO6 and a molecular weight of 547.83 g/mol. Its IUPAC name is (2S,2'R,6'R)-2'-(2-bromoethyl)-7-chloro-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione.
| Compound Name | (2S,2'R,6'R)-2'-(2-bromoethyl)-7-chloro-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione |
|---|---|
| PubChem CID | 73331628 |
| Molecular Formula | C26H24BrClO6 |
| Molecular Weight | 547.83 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | (2S,2'R,6'R)-2'-(2-bromoethyl)-7-chloro-4,6-dimethoxy-6'-methyl-2'-phenylspiro[1-benzofuran-2,7'-5,6-dihydro-3H-1-benzofuran]-3,4'-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C2=C(C[C@@](CCBr)(c3ccccc3)O2)C(=O)C[C@H]1C |
| InChI | InChI=1S/C26H24BrClO6/c1-14-11-17(29)16-13-25(9-10-27,15-7-5-4-6-8-15)34-24(16)26(14)23(30)20-18(31-2)12-19(32-3)21(28)22(20)33-26/h4-8,12,14H,9-11,13H2,1-3H3/t14-,25+,26-/m1/s1 |
| InChIKey | XRAJEIHWOSFQFE-DDHLINGLSA-N |
| XLogP | 5.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.83 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|