C27H28ClNO6 — CID 73331207
(2S,6'R)-7-chloro-2'-[4-[(dimethylamino)methyl]phenyl]-4,6-dimethoxy-6'-methylspiro[1-benzofuran-2,7'-2,3,5,6-tetrahydro-1-benzofuran]-3,4'-dione (PubChem CID 73331207) has the molecular formula C27H28ClNO6 and a molecular weight of 497.98 g/mol. Its IUPAC name is (2S,6'R)-7-chloro-2'-[4-[(dimethylamino)methyl]phenyl]-4,6-dimethoxy-6'-methylspiro[1-benzofuran-2,7'-2,3,5,6-tetrahydro-1-benzofuran]-3,4'-dione.
| Compound Name | (2S,6'R)-7-chloro-2'-[4-[(dimethylamino)methyl]phenyl]-4,6-dimethoxy-6'-methylspiro[1-benzofuran-2,7'-2,3,5,6-tetrahydro-1-benzofuran]-3,4'-dione |
|---|---|
| PubChem CID | 73331207 |
| Molecular Formula | C27H28ClNO6 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (2S,6'R)-7-chloro-2'-[4-[(dimethylamino)methyl]phenyl]-4,6-dimethoxy-6'-methylspiro[1-benzofuran-2,7'-2,3,5,6-tetrahydro-1-benzofuran]-3,4'-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C2=C(CC(c3ccc(CN(C)C)cc3)O2)C(=O)C[C@H]1C |
| InChI | InChI=1S/C27H28ClNO6/c1-14-10-18(30)17-11-19(16-8-6-15(7-9-16)13-29(2)3)34-26(17)27(14)25(31)22-20(32-4)12-21(33-5)23(28)24(22)35-27/h6-9,12,14,19H,10-11,13H2,1-5H3/t14-,19?,27-/m1/s1 |
| InChIKey | AQAYBVRWVBCQCL-BQEBOXFOSA-N |
| XLogP | 4.76 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |