C17H32O2 — CID 144565955
4-(2-butyl-2,3,6-trimethylcyclohexyl)-3-hydroxybutan-2-one (PubChem CID 144565955) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 4-(2-butyl-2,3,6-trimethylcyclohexyl)-3-hydroxybutan-2-one.
| Compound Name | 4-(2-butyl-2,3,6-trimethylcyclohexyl)-3-hydroxybutan-2-one |
|---|---|
| PubChem CID | 144565955 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 4-(2-butyl-2,3,6-trimethylcyclohexyl)-3-hydroxybutan-2-one |
| SMILES | CCCCC1(C)C(C)CCC(C)C1CC(O)C(C)=O |
| InChI | InChI=1S/C17H32O2/c1-6-7-10-17(5)13(3)9-8-12(2)15(17)11-16(19)14(4)18/h12-13,15-16,19H,6-11H2,1-5H3 |
| InChIKey | XMBFPDSQVGQKDC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |