C19H36O3 — CID 155737329
butyl 3-hydroxy-2-methylidene-4-(2,2,3-trimethylcyclopentyl)butanoate;ethane (PubChem CID 155737329) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is butyl 3-hydroxy-2-methylidene-4-(2,2,3-trimethylcyclopentyl)butanoate;ethane.
| Compound Name | butyl 3-hydroxy-2-methylidene-4-(2,2,3-trimethylcyclopentyl)butanoate;ethane |
|---|---|
| PubChem CID | 155737329 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | butyl 3-hydroxy-2-methylidene-4-(2,2,3-trimethylcyclopentyl)butanoate;ethane |
| SMILES | C=C(C(=O)OCCCC)C(O)CC1CCC(C)C1(C)C.CC |
| InChI | InChI=1S/C17H30O3.C2H6/c1-6-7-10-20-16(19)13(3)15(18)11-14-9-8-12(2)17(14,4)5;1-2/h12,14-15,18H,3,6-11H2,1-2,4-5H3;1-2H3 |
| InChIKey | VXLOIFSMRLQEOR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|