C29H30F2N8O2 — CID 144566236
(E)-4-amino-4-methyl-2-(pyrrolidine-1-carbonyl)pent-2-enenitrile;3-[2-fluoro-4-(3-fluorophenoxy)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 144566236) has the molecular formula C29H30F2N8O2 and a molecular weight of 560.61 g/mol. Its IUPAC name is (E)-4-amino-4-methyl-2-(pyrrolidine-1-carbonyl)pent-2-enenitrile;3-[2-fluoro-4-(3-fluorophenoxy)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | (E)-4-amino-4-methyl-2-(pyrrolidine-1-carbonyl)pent-2-enenitrile;3-[2-fluoro-4-(3-fluorophenoxy)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 144566236 |
| Molecular Formula | C29H30F2N8O2 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | (E)-4-amino-4-methyl-2-(pyrrolidine-1-carbonyl)pent-2-enenitrile;3-[2-fluoro-4-(3-fluorophenoxy)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC(C)(N)/C=C(\C#N)C(=O)N1CCCC1.Cn1nc(-c2ccc(Oc3cccc(F)c3)cc2F)c2c(N)ncnc21 |
| InChI | InChI=1S/C18H13F2N5O.C11H17N3O/c1-25-18-15(17(21)22-9-23-18)16(24-25)13-6-5-12(8-14(13)20)26-11-4-2-3-10(19)7-11;1-11(2,13)7-9(8-12)10(15)14-5-3-4-6-14/h2-9H,1H3,(H2,21,22,23);7H,3-6,13H2,1-2H3/b;9-7+ |
| InChIKey | DZQPBWWRAJSJPH-FXDYKFNQSA-N |
| XLogP | 4.48 |
| TPSA | 148.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|