C15H28N2 — CID 144567554
4,6-ditert-butyl-2-methylpyrimidine;ethane (PubChem CID 144567554) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 4,6-ditert-butyl-2-methylpyrimidine;ethane.
| Compound Name | 4,6-ditert-butyl-2-methylpyrimidine;ethane |
|---|---|
| PubChem CID | 144567554 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 4,6-ditert-butyl-2-methylpyrimidine;ethane |
| SMILES | CC.Cc1nc(C(C)(C)C)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H22N2.C2H6/c1-9-14-10(12(2,3)4)8-11(15-9)13(5,6)7;1-2/h8H,1-7H3;1-2H3 |
| InChIKey | AWHOLVHLLXJLPJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |