C14H10N2O — CID 144569124
16-methyl-3-oxa-14,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene (PubChem CID 144569124) has the molecular formula C14H10N2O and a molecular weight of 222.25 g/mol. Its IUPAC name is 16-methyl-3-oxa-14,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene.
| Compound Name | 16-methyl-3-oxa-14,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 144569124 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 16-methyl-3-oxa-14,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),4,7,10(15),11,13-heptaene |
| SMILES | Cn1c2ncccc2c2ccc3ccoc3c21 |
| InChI | InChI=1S/C14H10N2O/c1-16-12-10(11-3-2-7-15-14(11)16)5-4-9-6-8-17-13(9)12/h2-8H,1H3 |
| InChIKey | HISWPCODOOSYNN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |