C19H13N3 — CID 144569238
14-phenyl-8,10,12-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),13-heptaene (PubChem CID 144569238) has the molecular formula C19H13N3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 14-phenyl-8,10,12-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),13-heptaene.
| Compound Name | 14-phenyl-8,10,12-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),13-heptaene |
|---|---|
| PubChem CID | 144569238 |
| Molecular Formula | C19H13N3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 14-phenyl-8,10,12-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),13-heptaene |
| SMILES | c1ccc(-c2c[nH]c3nc4[nH]c5ccccc5c4cc23)cc1 |
| InChI | InChI=1S/C19H13N3/c1-2-6-12(7-3-1)16-11-20-18-15(16)10-14-13-8-4-5-9-17(13)21-19(14)22-18/h1-11H,(H2,20,21,22) |
| InChIKey | HHDBTPJAQWTTTP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |