C19H12N2Se — CID 144569142
14-phenyl-8-selena-10,12-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),13-heptaene (PubChem CID 144569142) has the molecular formula C19H12N2Se and a molecular weight of 347.28 g/mol. Its IUPAC name is 14-phenyl-8-selena-10,12-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),13-heptaene.
| Compound Name | 14-phenyl-8-selena-10,12-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),13-heptaene |
|---|---|
| PubChem CID | 144569142 |
| Molecular Formula | C19H12N2Se |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 14-phenyl-8-selena-10,12-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),13-heptaene |
| SMILES | c1ccc(-c2c[nH]c3nc4[se]c5ccccc5c4cc23)cc1 |
| InChI | InChI=1S/C19H12N2Se/c1-2-6-12(7-3-1)16-11-20-18-14(16)10-15-13-8-4-5-9-17(13)22-19(15)21-18/h1-11H,(H,20,21) |
| InChIKey | RMXIGPZGRAQCLB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|