C21H16F7NO5S — CID 144573132
[(2R,3S,4S)-4-fluoro-5-(hydroxyamino)-3-[4-(trifluoromethyl)benzoyl]oxythiolan-2-yl]methyl 4-(trifluoromethyl)benzoate (PubChem CID 144573132) has the molecular formula C21H16F7NO5S and a molecular weight of 527.41 g/mol. Its IUPAC name is [(2R,3S,4S)-4-fluoro-5-(hydroxyamino)-3-[4-(trifluoromethyl)benzoyl]oxythiolan-2-yl]methyl 4-(trifluoromethyl)benzoate.
| Compound Name | [(2R,3S,4S)-4-fluoro-5-(hydroxyamino)-3-[4-(trifluoromethyl)benzoyl]oxythiolan-2-yl]methyl 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 144573132 |
| Molecular Formula | C21H16F7NO5S |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | [(2R,3S,4S)-4-fluoro-5-(hydroxyamino)-3-[4-(trifluoromethyl)benzoyl]oxythiolan-2-yl]methyl 4-(trifluoromethyl)benzoate |
| SMILES | O=C(OC[C@H]1SC(NO)[C@@H](F)[C@@H]1OC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F7NO5S/c22-15-16(34-19(31)11-3-7-13(8-4-11)21(26,27)28)14(35-17(15)29-32)9-33-18(30)10-1-5-12(6-2-10)20(23,24)25/h1-8,14-17,29,32H,9H2/t14-,15+,16-,17?/m1/s1 |
| InChIKey | NNLLZDXCDGUNNG-LVYZTWJOSA-N |
| XLogP | 4.86 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|