C24H32F2N4O6S2 — CID 144574231
2-[[3,5-difluoro-4-(4-methylphenoxy)phenyl]sulfinyl-[2-[methyl(2-morpholin-4-ylethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide (PubChem CID 144574231) has the molecular formula C24H32F2N4O6S2 and a molecular weight of 574.67 g/mol. Its IUPAC name is 2-[[3,5-difluoro-4-(4-methylphenoxy)phenyl]sulfinyl-[2-[methyl(2-morpholin-4-ylethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide.
| Compound Name | 2-[[3,5-difluoro-4-(4-methylphenoxy)phenyl]sulfinyl-[2-[methyl(2-morpholin-4-ylethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 144574231 |
| Molecular Formula | C24H32F2N4O6S2 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 2-[[3,5-difluoro-4-(4-methylphenoxy)phenyl]sulfinyl-[2-[methyl(2-morpholin-4-ylethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide |
| SMILES | Cc1ccc(Oc2c(F)cc(S(=O)N(CCN(C)S(=O)CCN3CCOCC3)CC(=O)NO)cc2F)cc1 |
| InChI | InChI=1S/C24H32F2N4O6S2/c1-18-3-5-19(6-4-18)36-24-21(25)15-20(16-22(24)26)38(34)30(17-23(31)27-32)8-7-28(2)37(33)14-11-29-9-12-35-13-10-29/h3-6,15-16,32H,7-14,17H2,1-2H3,(H,27,31) |
| InChIKey | ZXNGTRXQXHRSBG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|