C27H39ClF2N4O6S — CID 144574253
2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-(dimethylamino)ethyl]amino]-N-hydroxyacetamide;ethane;2-pyrrolidin-1-ylethyl formate (PubChem CID 144574253) has the molecular formula C27H39ClF2N4O6S and a molecular weight of 621.15 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-(dimethylamino)ethyl]amino]-N-hydroxyacetamide;ethane;2-pyrrolidin-1-ylethyl formate.
| Compound Name | 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-(dimethylamino)ethyl]amino]-N-hydroxyacetamide;ethane;2-pyrrolidin-1-ylethyl formate |
|---|---|
| PubChem CID | 144574253 |
| Molecular Formula | C27H39ClF2N4O6S |
| Molecular Weight | 621.15 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-(dimethylamino)ethyl]amino]-N-hydroxyacetamide;ethane;2-pyrrolidin-1-ylethyl formate |
| SMILES | CC.CN(C)CCN(CC(=O)NO)S(=O)c1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1.O=COCCN1CCCC1 |
| InChI | InChI=1S/C18H20ClF2N3O4S.C7H13NO2.C2H6/c1-23(2)7-8-24(11-17(25)22-26)29(27)14-9-15(20)18(16(21)10-14)28-13-5-3-12(19)4-6-13;9-7-10-6-5-8-3-1-2-4-8;1-2/h3-6,9-10,26H,7-8,11H2,1-2H3,(H,22,25);7H,1-6H2;1-2H3 |
| InChIKey | QBHDFXPYSXUXSF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|