C27H35ClF2N4O4S2 — CID 142842519
2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfanyl-[2-[methyl(pyridin-4-ylmethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide;ethane (PubChem CID 142842519) has the molecular formula C27H35ClF2N4O4S2 and a molecular weight of 617.18 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfanyl-[2-[methyl(pyridin-4-ylmethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide;ethane.
| Compound Name | 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfanyl-[2-[methyl(pyridin-4-ylmethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide;ethane |
|---|---|
| PubChem CID | 142842519 |
| Molecular Formula | C27H35ClF2N4O4S2 |
| Molecular Weight | 617.18 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfanyl-[2-[methyl(pyridin-4-ylmethylsulfinyl)amino]ethyl]amino]-N-hydroxyacetamide;ethane |
| SMILES | CC.CC.CN(CCN(CC(=O)NO)Sc1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1)S(=O)Cc1ccncc1 |
| InChI | InChI=1S/C23H23ClF2N4O4S2.2C2H6/c1-29(36(33)15-16-6-8-27-9-7-16)10-11-30(14-22(31)28-32)35-19-12-20(25)23(21(26)13-19)34-18-4-2-17(24)3-5-18;2*1-2/h2-9,12-13,32H,10-11,14-15H2,1H3,(H,28,31);2*1-2H3 |
| InChIKey | YPXQHYGDBJABFV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.18 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|