C26H31ClF2N4O6S — CID 142842485
acetylene;2-pyrrolidin-1-ylethyl N-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-methylcarbamate (PubChem CID 142842485) has the molecular formula C26H31ClF2N4O6S and a molecular weight of 601.07 g/mol. Its IUPAC name is acetylene;2-pyrrolidin-1-ylethyl N-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | acetylene;2-pyrrolidin-1-ylethyl N-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 142842485 |
| Molecular Formula | C26H31ClF2N4O6S |
| Molecular Weight | 601.07 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | acetylene;2-pyrrolidin-1-ylethyl N-[2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfinyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-methylcarbamate |
| SMILES | C#C.CN(CCN(CC(=O)NO)S(=O)c1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1)C(=O)OCCN1CCCC1 |
| InChI | InChI=1S/C24H29ClF2N4O6S.C2H2/c1-29(24(33)36-13-12-30-8-2-3-9-30)10-11-31(16-22(32)28-34)38(35)19-14-20(26)23(21(27)15-19)37-18-6-4-17(25)5-7-18;1-2/h4-7,14-15,34H,2-3,8-13,16H2,1H3,(H,28,32);1-2H |
| InChIKey | MSJFTMBTSTVPPY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.07 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|