C23H31F2N3O6S — CID 144574255
ethane;ethyl N-[2-[[3,5-difluoro-4-(4-methylphenoxy)phenyl]sulfinyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-methylcarbamate (PubChem CID 144574255) has the molecular formula C23H31F2N3O6S and a molecular weight of 515.58 g/mol. Its IUPAC name is ethane;ethyl N-[2-[[3,5-difluoro-4-(4-methylphenoxy)phenyl]sulfinyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | ethane;ethyl N-[2-[[3,5-difluoro-4-(4-methylphenoxy)phenyl]sulfinyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 144574255 |
| Molecular Formula | C23H31F2N3O6S |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | ethane;ethyl N-[2-[[3,5-difluoro-4-(4-methylphenoxy)phenyl]sulfinyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CC.CCOC(=O)N(C)CCN(CC(=O)NO)S(=O)c1cc(F)c(Oc2ccc(C)cc2)c(F)c1 |
| InChI | InChI=1S/C21H25F2N3O6S.C2H6/c1-4-31-21(28)25(3)9-10-26(13-19(27)24-29)33(30)16-11-17(22)20(18(23)12-16)32-15-7-5-14(2)6-8-15;1-2/h5-8,11-12,29H,4,9-10,13H2,1-3H3,(H,24,27);1-2H3 |
| InChIKey | BJWPWNLEPSNVNF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|