C27H25ClFN3O3 — CID 144574759
methyl 4-[3-[(2-chloro-6-cyclohexylbenzoyl)amino]pyridine-2-carboximidoyl]-3-fluorobenzoate (PubChem CID 144574759) has the molecular formula C27H25ClFN3O3 and a molecular weight of 493.97 g/mol. Its IUPAC name is methyl 4-[3-[(2-chloro-6-cyclohexylbenzoyl)amino]pyridine-2-carboximidoyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[3-[(2-chloro-6-cyclohexylbenzoyl)amino]pyridine-2-carboximidoyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 144574759 |
| Molecular Formula | C27H25ClFN3O3 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | methyl 4-[3-[(2-chloro-6-cyclohexylbenzoyl)amino]pyridine-2-carboximidoyl]-3-fluorobenzoate |
| SMILES | [H]/N=C(\c1ccc(C(=O)OC)cc1F)c1ncccc1NC(=O)c1c(Cl)cccc1C1CCCCC1 |
| InChI | InChI=1S/C27H25ClFN3O3/c1-35-27(34)17-12-13-19(21(29)15-17)24(30)25-22(11-6-14-31-25)32-26(33)23-18(9-5-10-20(23)28)16-7-3-2-4-8-16/h5-6,9-16,30H,2-4,7-8H2,1H3,(H,32,33)/b30-24+ |
| InChIKey | IZLAVISFEZPBLQ-BGABXYSRSA-N |
| XLogP | 6.38 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|