C46H35NS — CID 144578886
9-(7,7-dimethylfluoreno[4,3-b][1]benzothiol-10-yl)-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenylcarbazole (PubChem CID 144578886) has the molecular formula C46H35NS and a molecular weight of 633.86 g/mol. Its IUPAC name is 9-(7,7-dimethylfluoreno[4,3-b][1]benzothiol-10-yl)-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenylcarbazole.
| Compound Name | 9-(7,7-dimethylfluoreno[4,3-b][1]benzothiol-10-yl)-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenylcarbazole |
|---|---|
| PubChem CID | 144578886 |
| Molecular Formula | C46H35NS |
| Molecular Weight | 633.86 g/mol |
| Exact Mass | 633.25 |
| IUPAC Name | 9-(7,7-dimethylfluoreno[4,3-b][1]benzothiol-10-yl)-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenylcarbazole |
| SMILES | C=C/C=C(\C=C/C)c1ccc2c(c1)c1cc(-c3ccccc3)ccc1n2-c1ccc2c(c1)-c1c(ccc3c1sc1ccccc13)C2(C)C |
| InChI | InChI=1S/C46H35NS/c1-5-12-29(13-6-2)31-18-24-41-36(26-31)37-27-32(30-14-8-7-9-15-30)19-25-42(37)47(41)33-20-22-39-38(28-33)44-40(46(39,3)4)23-21-35-34-16-10-11-17-43(34)48-45(35)44/h5-28H,1H2,2-4H3/b13-6-,29-12+ |
| InChIKey | VEGNWDXOWBAOBS-LENMGJOKSA-N |
| XLogP | 13.27 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.86 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|