C38H32N2 — CID 144579159
2-[(3Z,5E)-5-(9H-carbazol-2-yl)hepta-1,3,5-trien-2-yl]-N-[4-(4-methylphenyl)phenyl]aniline (PubChem CID 144579159) has the molecular formula C38H32N2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 2-[(3Z,5E)-5-(9H-carbazol-2-yl)hepta-1,3,5-trien-2-yl]-N-[4-(4-methylphenyl)phenyl]aniline.
| Compound Name | 2-[(3Z,5E)-5-(9H-carbazol-2-yl)hepta-1,3,5-trien-2-yl]-N-[4-(4-methylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 144579159 |
| Molecular Formula | C38H32N2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 2-[(3Z,5E)-5-(9H-carbazol-2-yl)hepta-1,3,5-trien-2-yl]-N-[4-(4-methylphenyl)phenyl]aniline |
| SMILES | C=C(/C=C\C(=C/C)c1ccc2c(c1)[nH]c1ccccc12)c1ccccc1Nc1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C38H32N2/c1-4-28(31-21-24-35-34-10-6-8-12-37(34)40-38(35)25-31)18-15-27(3)33-9-5-7-11-36(33)39-32-22-19-30(20-23-32)29-16-13-26(2)14-17-29/h4-25,39-40H,3H2,1-2H3/b18-15-,28-4+ |
| InChIKey | KIPCVKDVMYEHQX-PXKYQYKUSA-N |
| XLogP | 10.71 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|