C25H20ClFN4O4 — CID 144579718
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(2-fluoro-4-methanimidoylphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 144579718) has the molecular formula C25H20ClFN4O4 and a molecular weight of 494.91 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(2-fluoro-4-methanimidoylphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(2-fluoro-4-methanimidoylphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 144579718 |
| Molecular Formula | C25H20ClFN4O4 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(2-fluoro-4-methanimidoylphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | [H]/N=C/c1ccc(-c2ccc(-c3nc4nc(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)[nH]c4cc3Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C25H20ClFN4O4/c26-16-8-18-24(31-25(29-18)35-20-11-34-22-19(32)10-33-23(20)22)30-21(16)14-4-2-13(3-5-14)15-6-1-12(9-28)7-17(15)27/h1-9,19-20,22-23,28,32H,10-11H2,(H,29,30,31)/b28-9+/t19-,20-,22-,23-/m1/s1 |
| InChIKey | UOUOQGDQXGRJDB-NLEJCJMZSA-N |
| XLogP | 3.99 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|