C13H20N2 — CID 144580070
(Z,Z)-N-[(6E)-6-(2-methylpropylidene)-2,3-dihydropyridin-1-yl]but-2-en-1-imine (PubChem CID 144580070) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (Z,Z)-N-[(6E)-6-(2-methylpropylidene)-2,3-dihydropyridin-1-yl]but-2-en-1-imine.
| Compound Name | (Z,Z)-N-[(6E)-6-(2-methylpropylidene)-2,3-dihydropyridin-1-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 144580070 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (Z,Z)-N-[(6E)-6-(2-methylpropylidene)-2,3-dihydropyridin-1-yl]but-2-en-1-imine |
| SMILES | C/C=C\C=N/N1CCC=C/C1=C\C(C)C |
| InChI | InChI=1S/C13H20N2/c1-4-5-9-14-15-10-7-6-8-13(15)11-12(2)3/h4-6,8-9,11-12H,7,10H2,1-3H3/b5-4-,13-11+,14-9- |
| InChIKey | UULXDGNKPWYQHX-RSXKPSTQSA-N |
| XLogP | 3.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|