C15H20 — CID 144582721
1-(3,4-dimethylpent-1-en-3-yl)-4-ethenylbenzene (PubChem CID 144582721) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-(3,4-dimethylpent-1-en-3-yl)-4-ethenylbenzene.
| Compound Name | 1-(3,4-dimethylpent-1-en-3-yl)-4-ethenylbenzene |
|---|---|
| PubChem CID | 144582721 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-(3,4-dimethylpent-1-en-3-yl)-4-ethenylbenzene |
| SMILES | C=Cc1ccc(C(C)(C=C)C(C)C)cc1 |
| InChI | InChI=1S/C15H20/c1-6-13-8-10-14(11-9-13)15(5,7-2)12(3)4/h6-12H,1-2H2,3-5H3 |
| InChIKey | GLRXVZXWULVMIT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|