C12H23N — CID 144585252
(1E,3Z)-4-methyl-N-propan-2-ylocta-1,3-dien-1-amine (PubChem CID 144585252) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (1E,3Z)-4-methyl-N-propan-2-ylocta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-4-methyl-N-propan-2-ylocta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144585252 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (1E,3Z)-4-methyl-N-propan-2-ylocta-1,3-dien-1-amine |
| SMILES | CCCC/C(C)=C\C=C\NC(C)C |
| InChI | InChI=1S/C12H23N/c1-5-6-8-12(4)9-7-10-13-11(2)3/h7,9-11,13H,5-6,8H2,1-4H3/b10-7+,12-9- |
| InChIKey | COQSVQKRNXXANL-MLLAUDNSSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|