C13H20F3N — CID 144589103
(3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine (PubChem CID 144589103) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is (3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 144589103 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (3Z)-N-methyl-N-(3-methylbutyl)-5-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C)C(F)(F)F)N(C)CCC(C)C |
| InChI | InChI=1S/C13H20F3N/c1-10(2)8-9-17(5)12(4)7-6-11(3)13(14,15)16/h6-7,10H,3-4,8-9H2,1-2,5H3/b7-6- |
| InChIKey | GLBMAZPMVVZXMR-SREVYHEPSA-N |
| XLogP | 4.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|