C18H25N3O2 — CID 144590732
[2-amino-3-(benzylamino)-4-methylidenecyclohex-2-en-1-yl] N-propan-2-ylcarbamate (PubChem CID 144590732) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is [2-amino-3-(benzylamino)-4-methylidenecyclohex-2-en-1-yl] N-propan-2-ylcarbamate.
| Compound Name | [2-amino-3-(benzylamino)-4-methylidenecyclohex-2-en-1-yl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 144590732 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | [2-amino-3-(benzylamino)-4-methylidenecyclohex-2-en-1-yl] N-propan-2-ylcarbamate |
| SMILES | C=C1CCC(OC(=O)NC(C)C)C(N)=C1NCc1ccccc1 |
| InChI | InChI=1S/C18H25N3O2/c1-12(2)21-18(22)23-15-10-9-13(3)17(16(15)19)20-11-14-7-5-4-6-8-14/h4-8,12,15,20H,3,9-11,19H2,1-2H3,(H,21,22) |
| InChIKey | MFVBTTLXOVYIPF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |