C19H33N3O3 — CID 144590779
2-N-benzyl-3-methoxycyclohexene-1,2-diamine;methanol;N-propan-2-ylformamide (PubChem CID 144590779) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-N-benzyl-3-methoxycyclohexene-1,2-diamine;methanol;N-propan-2-ylformamide.
| Compound Name | 2-N-benzyl-3-methoxycyclohexene-1,2-diamine;methanol;N-propan-2-ylformamide |
|---|---|
| PubChem CID | 144590779 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 2-N-benzyl-3-methoxycyclohexene-1,2-diamine;methanol;N-propan-2-ylformamide |
| SMILES | CC(C)NC=O.CO.COC1CCCC(N)=C1NCc1ccccc1 |
| InChI | InChI=1S/C14H20N2O.C4H9NO.CH4O/c1-17-13-9-5-8-12(15)14(13)16-10-11-6-3-2-4-7-11;1-4(2)5-3-6;1-2/h2-4,6-7,13,16H,5,8-10,15H2,1H3;3-4H,1-2H3,(H,5,6);2H,1H3 |
| InChIKey | GSJOQFDRYUWTGS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|