C14H20N2O — CID 144590770
2-N-benzyl-3-methoxycyclohexene-1,2-diamine (PubChem CID 144590770) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-N-benzyl-3-methoxycyclohexene-1,2-diamine.
| Compound Name | 2-N-benzyl-3-methoxycyclohexene-1,2-diamine |
|---|---|
| PubChem CID | 144590770 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-N-benzyl-3-methoxycyclohexene-1,2-diamine |
| SMILES | COC1CCCC(N)=C1NCc1ccccc1 |
| InChI | InChI=1S/C14H20N2O/c1-17-13-9-5-8-12(15)14(13)16-10-11-6-3-2-4-7-11/h2-4,6-7,13,16H,5,8-10,15H2,1H3 |
| InChIKey | OAJLLKOYOQFQDT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |