C13H20N3O3S+ — CID 144591780
methyl-[3-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]propyl]sulfanium (PubChem CID 144591780) has the molecular formula C13H20N3O3S+ and a molecular weight of 298.39 g/mol. Its IUPAC name is methyl-[3-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]propyl]sulfanium.
| Compound Name | methyl-[3-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]propyl]sulfanium |
|---|---|
| PubChem CID | 144591780 |
| Molecular Formula | C13H20N3O3S+ |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | methyl-[3-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]propyl]sulfanium |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCC[SH+]C)c1=O |
| InChI | InChI=1S/C13H19N3O3S/c1-4-7-14-11(17)15(8-5-2)13(19)16(12(14)18)9-6-10-20-3/h4-5H,1-2,6-10H2,3H3/p+1 |
| InChIKey | FSQXXTNMSLKEKO-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|