C15H27N3O2S — CID 159423231
3-prop-2-enyl-1-propyl-5-(3-propylsulfanylpropyl)-1,3,5-triazinane-2,4-dione (PubChem CID 159423231) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is 3-prop-2-enyl-1-propyl-5-(3-propylsulfanylpropyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 3-prop-2-enyl-1-propyl-5-(3-propylsulfanylpropyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 159423231 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-prop-2-enyl-1-propyl-5-(3-propylsulfanylpropyl)-1,3,5-triazinane-2,4-dione |
| SMILES | C=CCN1C(=O)N(CCC)CN(CCCSCCC)C1=O |
| InChI | InChI=1S/C15H27N3O2S/c1-4-8-16-13-17(10-7-12-21-11-6-3)15(20)18(9-5-2)14(16)19/h5H,2,4,6-13H2,1,3H3 |
| InChIKey | LQAHFLDIIKGQOQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|