C16H16F3IN2O4S2 — CID 144595482
1-iodoethyl 2-[4-[4-(3,3,3-trifluoropropylsulfamoyl)phenyl]-1,3-thiazol-2-yl]acetate (PubChem CID 144595482) has the molecular formula C16H16F3IN2O4S2 and a molecular weight of 548.35 g/mol. Its IUPAC name is 1-iodoethyl 2-[4-[4-(3,3,3-trifluoropropylsulfamoyl)phenyl]-1,3-thiazol-2-yl]acetate.
| Compound Name | 1-iodoethyl 2-[4-[4-(3,3,3-trifluoropropylsulfamoyl)phenyl]-1,3-thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 144595482 |
| Molecular Formula | C16H16F3IN2O4S2 |
| Molecular Weight | 548.35 g/mol |
| Exact Mass | 547.95 |
| IUPAC Name | 1-iodoethyl 2-[4-[4-(3,3,3-trifluoropropylsulfamoyl)phenyl]-1,3-thiazol-2-yl]acetate |
| SMILES | CC(I)OC(=O)Cc1nc(-c2ccc(S(=O)(=O)NCCC(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C16H16F3IN2O4S2/c1-10(20)26-15(23)8-14-22-13(9-27-14)11-2-4-12(5-3-11)28(24,25)21-7-6-16(17,18)19/h2-5,9-10,21H,6-8H2,1H3 |
| InChIKey | AKBZVCKFMYSJHU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|