C30H27NO — CID 144597163
(1E,2Z,10Z,13E,17Z,19Z)-10-ethenyl-11-[(Z)-2-phenylethenyl]-22-oxa-12-azatricyclo[13.7.0.04,9]docosa-1(15),2,4,6,8,10,13,17,19-nonaene (PubChem CID 144597163) has the molecular formula C30H27NO and a molecular weight of 417.55 g/mol. Its IUPAC name is (1E,2Z,10Z,13E,17Z,19Z)-10-ethenyl-11-[(Z)-2-phenylethenyl]-22-oxa-12-azatricyclo[13.7.0.04,9]docosa-1(15),2,4,6,8,10,13,17,19-nonaene.
| Compound Name | (1E,2Z,10Z,13E,17Z,19Z)-10-ethenyl-11-[(Z)-2-phenylethenyl]-22-oxa-12-azatricyclo[13.7.0.04,9]docosa-1(15),2,4,6,8,10,13,17,19-nonaene |
|---|---|
| PubChem CID | 144597163 |
| Molecular Formula | C30H27NO |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (1E,2Z,10Z,13E,17Z,19Z)-10-ethenyl-11-[(Z)-2-phenylethenyl]-22-oxa-12-azatricyclo[13.7.0.04,9]docosa-1(15),2,4,6,8,10,13,17,19-nonaene |
| SMILES | C=C/C1=C(\C=C/c2ccccc2)N/C=C\C2=C(/C=C\c3ccccc31)OC/C=C\C=C/C2 |
| InChI | InChI=1S/C30H27NO/c1-2-27-28-16-10-9-14-25(28)18-20-30-26(15-8-3-4-11-23-32-30)21-22-31-29(27)19-17-24-12-6-5-7-13-24/h2-14,16-22,31H,1,15,23H2/b8-3-,11-4-,19-17-,20-18-,22-21-,29-27-,30-26+ |
| InChIKey | LSXXMYFROUJPHT-YKZDXCTBSA-N |
| XLogP | 7.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |